C10H19NO5S — CID 102659654
2-[1-(2-ethylsulfonylethyl)-3-methylazetidin-3-yl]oxyacetic acid (PubChem CID 102659654) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-[1-(2-ethylsulfonylethyl)-3-methylazetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-(2-ethylsulfonylethyl)-3-methylazetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102659654 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-[1-(2-ethylsulfonylethyl)-3-methylazetidin-3-yl]oxyacetic acid |
| SMILES | CCS(=O)(=O)CCN1CC(C)(OCC(=O)O)C1 |
| InChI | InChI=1S/C10H19NO5S/c1-3-17(14,15)5-4-11-7-10(2,8-11)16-6-9(12)13/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | ZFYLBSYAQMZYKO-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |