C7H10F3NO5S — CID 102657711
2-[3-methyl-1-(trifluoromethylsulfonyl)azetidin-3-yl]oxyacetic acid (PubChem CID 102657711) has the molecular formula C7H10F3NO5S and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-[3-methyl-1-(trifluoromethylsulfonyl)azetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[3-methyl-1-(trifluoromethylsulfonyl)azetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102657711 |
| Molecular Formula | C7H10F3NO5S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-[3-methyl-1-(trifluoromethylsulfonyl)azetidin-3-yl]oxyacetic acid |
| SMILES | CC1(OCC(=O)O)CN(S(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H10F3NO5S/c1-6(16-2-5(12)13)3-11(4-6)17(14,15)7(8,9)10/h2-4H2,1H3,(H,12,13) |
| InChIKey | BXFXLPJHDBBDGE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |