C14H18ClNO5 — CID 102659926
2-[1-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]-3-methylazetidin-3-yl]oxyacetic acid (PubChem CID 102659926) has the molecular formula C14H18ClNO5 and a molecular weight of 315.75 g/mol. Its IUPAC name is 2-[1-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]-3-methylazetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]-3-methylazetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102659926 |
| Molecular Formula | C14H18ClNO5 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[1-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]-3-methylazetidin-3-yl]oxyacetic acid |
| SMILES | COc1cc(Cl)cc(CN2CC(C)(OCC(=O)O)C2)c1O |
| InChI | InChI=1S/C14H18ClNO5/c1-14(21-6-12(17)18)7-16(8-14)5-9-3-10(15)4-11(20-2)13(9)19/h3-4,19H,5-8H2,1-2H3,(H,17,18) |
| InChIKey | OMOGAAITRKESMW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|