C12H14ClNO6 — CID 104667211
2-[carboxymethyl-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]amino]acetic acid (PubChem CID 104667211) has the molecular formula C12H14ClNO6 and a molecular weight of 303.70 g/mol. Its IUPAC name is 2-[carboxymethyl-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 104667211 |
| Molecular Formula | C12H14ClNO6 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[carboxymethyl-[(5-chloro-2-hydroxy-3-methoxyphenyl)methyl]amino]acetic acid |
| SMILES | COc1cc(Cl)cc(CN(CC(=O)O)CC(=O)O)c1O |
| InChI | InChI=1S/C12H14ClNO6/c1-20-9-3-8(13)2-7(12(9)19)4-14(5-10(15)16)6-11(17)18/h2-3,19H,4-6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | GPHDQJULOPMRGI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|