C15H24ClNO4 — CID 104643533
4-chloro-2-methoxy-6-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]phenol (PubChem CID 104643533) has the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. Its IUPAC name is 4-chloro-2-methoxy-6-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-methoxy-6-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 104643533 |
| Molecular Formula | C15H24ClNO4 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-chloro-2-methoxy-6-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]phenol |
| SMILES | COCCN(Cc1cc(Cl)cc(OC)c1O)C(C)COC |
| InChI | InChI=1S/C15H24ClNO4/c1-11(10-20-3)17(5-6-19-2)9-12-7-13(16)8-14(21-4)15(12)18/h7-8,11,18H,5-6,9-10H2,1-4H3 |
| InChIKey | OPTHSKQIPBMOEO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|