C17H20ClNO2 — CID 104667284
4-chloro-2-methoxy-6-[(N,3,5-trimethylanilino)methyl]phenol (PubChem CID 104667284) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 4-chloro-2-methoxy-6-[(N,3,5-trimethylanilino)methyl]phenol.
| Compound Name | 4-chloro-2-methoxy-6-[(N,3,5-trimethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 104667284 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-chloro-2-methoxy-6-[(N,3,5-trimethylanilino)methyl]phenol |
| SMILES | COc1cc(Cl)cc(CN(C)c2cc(C)cc(C)c2)c1O |
| InChI | InChI=1S/C17H20ClNO2/c1-11-5-12(2)7-15(6-11)19(3)10-13-8-14(18)9-16(21-4)17(13)20/h5-9,20H,10H2,1-4H3 |
| InChIKey | AWABLUZIRMGTNV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|