C10H10N2O2S — CID 102660365
[5-(phenylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]methanol (PubChem CID 102660365) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is [5-(phenylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]methanol.
| Compound Name | [5-(phenylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]methanol |
|---|---|
| PubChem CID | 102660365 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | [5-(phenylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]methanol |
| SMILES | OCc1noc(CSc2ccccc2)n1 |
| InChI | InChI=1S/C10H10N2O2S/c13-6-9-11-10(14-12-9)7-15-8-4-2-1-3-5-8/h1-5,13H,6-7H2 |
| InChIKey | YKWIBQAIXARPJZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |