C11H11ClN2OS2 — CID 102661076
3-(1-chloroethyl)-5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,2,4-oxadiazole (PubChem CID 102661076) has the molecular formula C11H11ClN2OS2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloroethyl)-5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102661076 |
| Molecular Formula | C11H11ClN2OS2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 3-(1-chloroethyl)-5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1noc(-c2cc3c(s2)CCSC3)n1 |
| InChI | InChI=1S/C11H11ClN2OS2/c1-6(12)10-13-11(15-14-10)9-4-7-5-16-3-2-8(7)17-9/h4,6H,2-3,5H2,1H3 |
| InChIKey | GZIQJPIAARRLPP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|