C15H24N2O3S — CID 102661427
1-[1-(2-ethoxyethylsulfonyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine (PubChem CID 102661427) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[1-(2-ethoxyethylsulfonyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine.
| Compound Name | 1-[1-(2-ethoxyethylsulfonyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine |
|---|---|
| PubChem CID | 102661427 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-[1-(2-ethoxyethylsulfonyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine |
| SMILES | CCOCCS(=O)(=O)N1CCCc2cc(C(C)N)ccc21 |
| InChI | InChI=1S/C15H24N2O3S/c1-3-20-9-10-21(18,19)17-8-4-5-14-11-13(12(2)16)6-7-15(14)17/h6-7,11-12H,3-5,8-10,16H2,1-2H3 |
| InChIKey | NGZFEKNAMJSAJU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|