C14H22N2O2S — CID 102661429
1-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanamine (PubChem CID 102661429) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanamine.
| Compound Name | 1-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanamine |
|---|---|
| PubChem CID | 102661429 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanamine |
| SMILES | CCCS(=O)(=O)N1CCCc2cc(C(C)N)ccc21 |
| InChI | InChI=1S/C14H22N2O2S/c1-3-9-19(17,18)16-8-4-5-13-10-12(11(2)15)6-7-14(13)16/h6-7,10-11H,3-5,8-9,15H2,1-2H3 |
| InChIKey | PKKZAOOLKJACRD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |