C16H14ClFN2O — CID 102663705
4-[[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]methyl]-3-chlorobenzonitrile (PubChem CID 102663705) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is 4-[[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]methyl]-3-chlorobenzonitrile.
| Compound Name | 4-[[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]methyl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 102663705 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-[[2-[(1S)-1-aminoethyl]-4-fluorophenoxy]methyl]-3-chlorobenzonitrile |
| SMILES | C[C@H](N)c1cc(F)ccc1OCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C16H14ClFN2O/c1-10(20)14-7-13(18)4-5-16(14)21-9-12-3-2-11(8-19)6-15(12)17/h2-7,10H,9,20H2,1H3/t10-/m0/s1 |
| InChIKey | RMKHSXSVHIZCFE-JTQLQIEISA-N |
| XLogP | 3.95 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |