C16H13BrClNO2 — CID 102668663
4-[[4-bromo-2-(1-hydroxyethyl)phenoxy]methyl]-3-chlorobenzonitrile (PubChem CID 102668663) has the molecular formula C16H13BrClNO2 and a molecular weight of 366.64 g/mol. Its IUPAC name is 4-[[4-bromo-2-(1-hydroxyethyl)phenoxy]methyl]-3-chlorobenzonitrile.
| Compound Name | 4-[[4-bromo-2-(1-hydroxyethyl)phenoxy]methyl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 102668663 |
| Molecular Formula | C16H13BrClNO2 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 4-[[4-bromo-2-(1-hydroxyethyl)phenoxy]methyl]-3-chlorobenzonitrile |
| SMILES | CC(O)c1cc(Br)ccc1OCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C16H13BrClNO2/c1-10(20)14-7-13(17)4-5-16(14)21-9-12-3-2-11(8-19)6-15(12)18/h2-7,10,20H,9H2,1H3 |
| InChIKey | AUJQHNXGTOGLCJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |