About 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile
3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile (PubChem CID 102664408) has the molecular formula C12H12ClN5
and a molecular weight of 261.72 g/mol. Its IUPAC name is 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile |
| PubChem CID | 102664408 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile |
| SMILES | Cn1cnnc1CNCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C12H12ClN5/c1-18-8-16-17-12(18)7-15-6-10-3-2-9(5-14)4-11(10)13/h2-4,8,15H,6-7H2,1H3 |
| InChIKey | IIXRMGQRRBBTQA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile?
The IUPAC name of 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile (CID 102664408) is 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile.
What is the SMILES notation for 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile?
The canonical SMILES for 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile is Cn1cnnc1CNCc1ccc(C#N)cc1Cl.
What is the InChIKey of 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile?
The InChIKey is IIXRMGQRRBBTQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN5/c1-18-8-16-17-12(18)7-15-6-10-3-2-9(5-14)4-11(10)13/h2-4,8,15H,6-7H2,1H3.
What are the key properties of 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile?
3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile has a molecular weight of 261.72 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[[(4-methyl-1,2,4-triazol-3-yl)methylamino]methyl]benzonitrile is sourced from PubChem (CID 102664408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).