C12H15ClN2S — CID 102664562
3-chloro-4-[(3-methylsulfanylpropylamino)methyl]benzonitrile (PubChem CID 102664562) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 3-chloro-4-[(3-methylsulfanylpropylamino)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(3-methylsulfanylpropylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102664562 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-chloro-4-[(3-methylsulfanylpropylamino)methyl]benzonitrile |
| SMILES | CSCCCNCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C12H15ClN2S/c1-16-6-2-5-15-9-11-4-3-10(8-14)7-12(11)13/h3-4,7,15H,2,5-6,9H2,1H3 |
| InChIKey | QNSWGEMZUKKTNE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|