C14H17ClN2O2 — CID 102664608
ethyl 4-[(2-chloro-4-cyanophenyl)methylamino]butanoate (PubChem CID 102664608) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-4-cyanophenyl)methylamino]butanoate.
| Compound Name | ethyl 4-[(2-chloro-4-cyanophenyl)methylamino]butanoate |
|---|---|
| PubChem CID | 102664608 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | ethyl 4-[(2-chloro-4-cyanophenyl)methylamino]butanoate |
| SMILES | CCOC(=O)CCCNCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C14H17ClN2O2/c1-2-19-14(18)4-3-7-17-10-12-6-5-11(9-16)8-13(12)15/h5-6,8,17H,2-4,7,10H2,1H3 |
| InChIKey | VTRYWBSPOCSKOX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|