C14H17ClN2O — CID 102664536
3-chloro-4-[(oxan-4-ylmethylamino)methyl]benzonitrile (PubChem CID 102664536) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-chloro-4-[(oxan-4-ylmethylamino)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(oxan-4-ylmethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102664536 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-chloro-4-[(oxan-4-ylmethylamino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNCC2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O/c15-14-7-12(8-16)1-2-13(14)10-17-9-11-3-5-18-6-4-11/h1-2,7,11,17H,3-6,9-10H2 |
| InChIKey | BIGBTJYYTUCFJH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |