C12H13ClN2O — CID 102664571
4-[(but-3-ynylamino)methyl]-3-chlorobenzamide (PubChem CID 102664571) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 4-[(but-3-ynylamino)methyl]-3-chlorobenzamide.
| Compound Name | 4-[(but-3-ynylamino)methyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 102664571 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-[(but-3-ynylamino)methyl]-3-chlorobenzamide |
| SMILES | C#CCCNCc1ccc(C(N)=O)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O/c1-2-3-6-15-8-10-5-4-9(12(14)16)7-11(10)13/h1,4-5,7,15H,3,6,8H2,(H2,14,16) |
| InChIKey | QETMOOGZTQRTNT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|