C15H21ClN2O2 — CID 106133041
3-chloro-4-[[(4-hydroxycyclohexyl)methylamino]methyl]benzamide (PubChem CID 106133041) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 3-chloro-4-[[(4-hydroxycyclohexyl)methylamino]methyl]benzamide.
| Compound Name | 3-chloro-4-[[(4-hydroxycyclohexyl)methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 106133041 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-chloro-4-[[(4-hydroxycyclohexyl)methylamino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CNCC2CCC(O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O2/c16-14-7-11(15(17)20)3-4-12(14)9-18-8-10-1-5-13(19)6-2-10/h3-4,7,10,13,18-19H,1-2,5-6,8-9H2,(H2,17,20) |
| InChIKey | DKWXBPOKIKUGIB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |