C14H8ClF3N2 — CID 102664684
3-chloro-4-[(2,4,6-trifluoroanilino)methyl]benzonitrile (PubChem CID 102664684) has the molecular formula C14H8ClF3N2 and a molecular weight of 296.68 g/mol. Its IUPAC name is 3-chloro-4-[(2,4,6-trifluoroanilino)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(2,4,6-trifluoroanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102664684 |
| Molecular Formula | C14H8ClF3N2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 3-chloro-4-[(2,4,6-trifluoroanilino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2c(F)cc(F)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C14H8ClF3N2/c15-11-3-8(6-19)1-2-9(11)7-20-14-12(17)4-10(16)5-13(14)18/h1-5,20H,7H2 |
| InChIKey | HDWDBCGQGUGPQE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |