C14H11ClF3N — CID 106862809
N-[(2-chloro-4-methylphenyl)methyl]-2,4,6-trifluoroaniline (PubChem CID 106862809) has the molecular formula C14H11ClF3N and a molecular weight of 285.70 g/mol. Its IUPAC name is N-[(2-chloro-4-methylphenyl)methyl]-2,4,6-trifluoroaniline.
| Compound Name | N-[(2-chloro-4-methylphenyl)methyl]-2,4,6-trifluoroaniline |
|---|---|
| PubChem CID | 106862809 |
| Molecular Formula | C14H11ClF3N |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-[(2-chloro-4-methylphenyl)methyl]-2,4,6-trifluoroaniline |
| SMILES | Cc1ccc(CNc2c(F)cc(F)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClF3N/c1-8-2-3-9(11(15)4-8)7-19-14-12(17)5-10(16)6-13(14)18/h2-6,19H,7H2,1H3 |
| InChIKey | YVYSAUKWEZXPCC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |