C13H15ClN2 — CID 102665286
3-chloro-4-[[cyclopropyl(ethyl)amino]methyl]benzonitrile (PubChem CID 102665286) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 3-chloro-4-[[cyclopropyl(ethyl)amino]methyl]benzonitrile.
| Compound Name | 3-chloro-4-[[cyclopropyl(ethyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 102665286 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-chloro-4-[[cyclopropyl(ethyl)amino]methyl]benzonitrile |
| SMILES | CCN(Cc1ccc(C#N)cc1Cl)C1CC1 |
| InChI | InChI=1S/C13H15ClN2/c1-2-16(12-5-6-12)9-11-4-3-10(8-15)7-13(11)14/h3-4,7,12H,2,5-6,9H2,1H3 |
| InChIKey | NLBIZBXHAVCISR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |