C16H28O3Si — CID 10266602
(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclohex-2-ene-1,2-dicarbaldehyde (PubChem CID 10266602) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is (1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclohex-2-ene-1,2-dicarbaldehyde.
| Compound Name | (1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclohex-2-ene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 10266602 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclohex-2-ene-1,2-dicarbaldehyde |
| SMILES | CCC1=C(C=O)[C@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28O3Si/c1-7-12-8-9-15(14(11-18)13(12)10-17)19-20(5,6)16(2,3)4/h10-11,14-15H,7-9H2,1-6H3/t14-,15-/m0/s1 |
| InChIKey | KPASJRKPJUQRHV-GJZGRUSLSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|