C16H28O3Si — CID 139608745
3-[2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]-2-methylbut-2-enal (PubChem CID 139608745) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]-2-methylbut-2-enal.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]-2-methylbut-2-enal |
|---|---|
| PubChem CID | 139608745 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]-2-methylbut-2-enal |
| SMILES | CC(C=O)=C(C)C1CC(=O)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O3Si/c1-11(10-17)12(2)14-8-13(18)9-15(14)19-20(6,7)16(3,4)5/h10,14-15H,8-9H2,1-7H3 |
| InChIKey | BGFWWLQWQODIHK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|