C19H34O3Si — CID 85114455
6-[tert-butyl(dimethyl)silyl]oxy-3-pentylcyclohex-2-ene-1,2-dicarbaldehyde (PubChem CID 85114455) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-3-pentylcyclohex-2-ene-1,2-dicarbaldehyde.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-3-pentylcyclohex-2-ene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 85114455 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-3-pentylcyclohex-2-ene-1,2-dicarbaldehyde |
| SMILES | CCCCCC1=C(C=O)C(C=O)C(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H34O3Si/c1-7-8-9-10-15-11-12-18(17(14-21)16(15)13-20)22-23(5,6)19(2,3)4/h13-14,17-18H,7-12H2,1-6H3 |
| InChIKey | FGMQZPCQDCZSID-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|