C22H40O3Si — CID 85080803
6-[tert-butyl(dimethyl)silyl]oxy-3-octylcyclohex-2-ene-1,2-dicarbaldehyde (PubChem CID 85080803) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-3-octylcyclohex-2-ene-1,2-dicarbaldehyde.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-3-octylcyclohex-2-ene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 85080803 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-3-octylcyclohex-2-ene-1,2-dicarbaldehyde |
| SMILES | CCCCCCCCC1=C(C=O)C(C=O)C(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H40O3Si/c1-7-8-9-10-11-12-13-18-14-15-21(20(17-24)19(18)16-23)25-26(5,6)22(2,3)4/h16-17,20-21H,7-15H2,1-6H3 |
| InChIKey | AIHRYQCAAURXTR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|