C14H20ClN3OS — CID 102666131
2-[(4-carbamothioyl-2-chlorophenyl)methyl-ethylamino]-N,N-dimethylacetamide (PubChem CID 102666131) has the molecular formula C14H20ClN3OS and a molecular weight of 313.85 g/mol. Its IUPAC name is 2-[(4-carbamothioyl-2-chlorophenyl)methyl-ethylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(4-carbamothioyl-2-chlorophenyl)methyl-ethylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102666131 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[(4-carbamothioyl-2-chlorophenyl)methyl-ethylamino]-N,N-dimethylacetamide |
| SMILES | CCN(CC(=O)N(C)C)Cc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C14H20ClN3OS/c1-4-18(9-13(19)17(2)3)8-11-6-5-10(14(16)20)7-12(11)15/h5-7H,4,8-9H2,1-3H3,(H2,16,20) |
| InChIKey | YOVGJLDQOCLWRC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|