C15H23ClN2S — CID 102666185
3-chloro-4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]benzenecarbothioamide (PubChem CID 102666185) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 3-chloro-4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102666185 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-chloro-4-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]benzenecarbothioamide |
| SMILES | CC(N(C)Cc1ccc(C(N)=S)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H23ClN2S/c1-10(15(2,3)4)18(5)9-12-7-6-11(14(17)19)8-13(12)16/h6-8,10H,9H2,1-5H3,(H2,17,19) |
| InChIKey | QDYFFEKBAIFDND-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|