C14H19ClN2OS — CID 102666326
3-chloro-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]benzenecarbothioamide (PubChem CID 102666326) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 3-chloro-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102666326 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-chloro-4-[[methyl-(2-methyloxolan-3-yl)amino]methyl]benzenecarbothioamide |
| SMILES | CC1OCCC1N(C)Cc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C14H19ClN2OS/c1-9-13(5-6-18-9)17(2)8-11-4-3-10(14(16)19)7-12(11)15/h3-4,7,9,13H,5-6,8H2,1-2H3,(H2,16,19) |
| InChIKey | SEHGZINKCWHNME-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|