C16H18ClN3O — CID 102666909
3-chloro-4-[(N,2-dimethylanilino)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 102666909) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 3-chloro-4-[(N,2-dimethylanilino)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-chloro-4-[(N,2-dimethylanilino)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 102666909 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-chloro-4-[(N,2-dimethylanilino)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1ccccc1N(C)Cc1ccc(/C(N)=N/O)cc1Cl |
| InChI | InChI=1S/C16H18ClN3O/c1-11-5-3-4-6-15(11)20(2)10-13-8-7-12(9-14(13)17)16(18)19-21/h3-9,21H,10H2,1-2H3,(H2,18,19) |
| InChIKey | YKVWCIDYZWOEJS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|