C14H22ClN3 — CID 102667719
4-[[butyl(ethyl)amino]methyl]-3-chlorobenzenecarboximidamide (PubChem CID 102667719) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 4-[[butyl(ethyl)amino]methyl]-3-chlorobenzenecarboximidamide.
| Compound Name | 4-[[butyl(ethyl)amino]methyl]-3-chlorobenzenecarboximidamide |
|---|---|
| PubChem CID | 102667719 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[[butyl(ethyl)amino]methyl]-3-chlorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(CC)CCCC)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClN3/c1-3-5-8-18(4-2)10-12-7-6-11(14(16)17)9-13(12)15/h6-7,9H,3-5,8,10H2,1-2H3,(H3,16,17) |
| InChIKey | WXZCEGDUNRJDEC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|