C15H24ClN3O — CID 102667847
3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzenecarboximidamide (PubChem CID 102667847) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102667847 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(CCO)C(CC)CC)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClN3O/c1-3-13(4-2)19(7-8-20)10-12-6-5-11(15(17)18)9-14(12)16/h5-6,9,13,20H,3-4,7-8,10H2,1-2H3,(H3,17,18) |
| InChIKey | HLRKQQUKJHHLNU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|