C15H23ClN2O2 — CID 102669681
3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzamide (PubChem CID 102669681) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzamide.
| Compound Name | 3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 102669681 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-chloro-4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]benzamide |
| SMILES | CCC(CC)N(CCO)Cc1ccc(C(N)=O)cc1Cl |
| InChI | InChI=1S/C15H23ClN2O2/c1-3-13(4-2)18(7-8-19)10-12-6-5-11(15(17)20)9-14(12)16/h5-6,9,13,19H,3-4,7-8,10H2,1-2H3,(H2,17,20) |
| InChIKey | OJUSRDQBYQKKSO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |