C15H20ClN3O — CID 102667935
3-chloro-4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzenecarboximidamide (PubChem CID 102667935) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 3-chloro-4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102667935 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-chloro-4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2C3CCC2CC(O)C3)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O/c16-14-5-9(15(17)18)1-2-10(14)8-19-11-3-4-12(19)7-13(20)6-11/h1-2,5,11-13,20H,3-4,6-8H2,(H3,17,18) |
| InChIKey | VDQBJHXJKTZPAO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|