C14H20ClN3S — CID 102668014
3-chloro-4-[(2,2-dimethylthiomorpholin-4-yl)methyl]benzenecarboximidamide (PubChem CID 102668014) has the molecular formula C14H20ClN3S and a molecular weight of 297.86 g/mol. Its IUPAC name is 3-chloro-4-[(2,2-dimethylthiomorpholin-4-yl)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-4-[(2,2-dimethylthiomorpholin-4-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102668014 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-chloro-4-[(2,2-dimethylthiomorpholin-4-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CCSC(C)(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClN3S/c1-14(2)9-18(5-6-19-14)8-11-4-3-10(13(16)17)7-12(11)15/h3-4,7H,5-6,8-9H2,1-2H3,(H3,16,17) |
| InChIKey | VJLYVHLZCJKZQF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|