C11H17NOS — CID 102671359
N-[2-(furan-2-yl)ethyl]-2-methylthiolan-3-amine (PubChem CID 102671359) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2-methylthiolan-3-amine.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2-methylthiolan-3-amine |
|---|---|
| PubChem CID | 102671359 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2-methylthiolan-3-amine |
| SMILES | CC1SCCC1NCCc1ccco1 |
| InChI | InChI=1S/C11H17NOS/c1-9-11(5-8-14-9)12-6-4-10-3-2-7-13-10/h2-3,7,9,11-12H,4-6,8H2,1H3 |
| InChIKey | ZBYJFGYNPTXQOW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |