C10H15NO4S — CID 42344850
(3S,4S)-4-[2-(furan-2-yl)ethylamino]-1,1-dioxothiolan-3-ol (PubChem CID 42344850) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is (3S,4S)-4-[2-(furan-2-yl)ethylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-[2-(furan-2-yl)ethylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 42344850 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3S,4S)-4-[2-(furan-2-yl)ethylamino]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](NCCc2ccco2)C1 |
| InChI | InChI=1S/C10H15NO4S/c12-10-7-16(13,14)6-9(10)11-4-3-8-2-1-5-15-8/h1-2,5,9-12H,3-4,6-7H2/t9-,10-/m1/s1 |
| InChIKey | KPEFFIAJZCHOSO-NXEZZACHSA-N |
| XLogP | -0.43 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |