C12H21NO — CID 102672599
N-[2-(oxolan-3-yl)ethyl]cyclohex-2-en-1-amine (PubChem CID 102672599) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[2-(oxolan-3-yl)ethyl]cyclohex-2-en-1-amine.
| Compound Name | N-[2-(oxolan-3-yl)ethyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 102672599 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[2-(oxolan-3-yl)ethyl]cyclohex-2-en-1-amine |
| SMILES | C1=CC(NCCC2CCOC2)CCC1 |
| InChI | InChI=1S/C12H21NO/c1-2-4-12(5-3-1)13-8-6-11-7-9-14-10-11/h2,4,11-13H,1,3,5-10H2 |
| InChIKey | UPCFHMCKTHMPGO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|