C9H16N2O — CID 163511528
4-(oxolan-3-yl)-1,2,3,6-tetrahydropyridin-3-amine (PubChem CID 163511528) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-(oxolan-3-yl)-1,2,3,6-tetrahydropyridin-3-amine.
| Compound Name | 4-(oxolan-3-yl)-1,2,3,6-tetrahydropyridin-3-amine |
|---|---|
| PubChem CID | 163511528 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4-(oxolan-3-yl)-1,2,3,6-tetrahydropyridin-3-amine |
| SMILES | NC1CNCC=C1C1CCOC1 |
| InChI | InChI=1S/C9H16N2O/c10-9-5-11-3-1-8(9)7-2-4-12-6-7/h1,7,9,11H,2-6,10H2 |
| InChIKey | DDCNPJRWHALXHQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|