C12H26N2S — CID 102672813
N',N'-diethyl-N-(2-methylthiolan-3-yl)propane-1,3-diamine (PubChem CID 102672813) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-methylthiolan-3-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(2-methylthiolan-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 102672813 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N',N'-diethyl-N-(2-methylthiolan-3-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNC1CCSC1C |
| InChI | InChI=1S/C12H26N2S/c1-4-14(5-2)9-6-8-13-12-7-10-15-11(12)3/h11-13H,4-10H2,1-3H3 |
| InChIKey | JTAYUXWJEFZSFO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|