C10H22N2S — CID 79957665
N'-(2-methylthian-3-yl)butane-1,4-diamine (PubChem CID 79957665) has the molecular formula C10H22N2S and a molecular weight of 202.37 g/mol. Its IUPAC name is N'-(2-methylthian-3-yl)butane-1,4-diamine.
| Compound Name | N'-(2-methylthian-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 79957665 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N'-(2-methylthian-3-yl)butane-1,4-diamine |
| SMILES | CC1SCCCC1NCCCCN |
| InChI | InChI=1S/C10H22N2S/c1-9-10(5-4-8-13-9)12-7-3-2-6-11/h9-10,12H,2-8,11H2,1H3 |
| InChIKey | OHRBBAAQIDNANF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|