C12H23NO3 — CID 102673023
2,2-dimethyl-N-[2-(oxolan-3-yl)ethyl]-1,3-dioxan-5-amine (PubChem CID 102673023) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-(oxolan-3-yl)ethyl]-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-[2-(oxolan-3-yl)ethyl]-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 102673023 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2,2-dimethyl-N-[2-(oxolan-3-yl)ethyl]-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(NCCC2CCOC2)CO1 |
| InChI | InChI=1S/C12H23NO3/c1-12(2)15-8-11(9-16-12)13-5-3-10-4-6-14-7-10/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | RERWZGPFTAVZKL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |