3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid

C9H17NO4 — CID 106658180

IUPAC3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid
SMILESCC1(C)OCC(NCCC(=O)O)CO1
InChIInChI=1S/C9H17NO4/c1-9(2)13-5-7(6-14-9)10-4-3-8(11)12/h7,10H,3-6H2,1-2H3,(H,11,12)
InChIKeyLEJDJZDBZBBKEU-UHFFFAOYSA-N
MW203.24 g/mol
LogP0.20
Rot. Bonds4

About 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid

3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid (PubChem CID 106658180) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid.

Molecular Properties

Compound Name3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid
PubChem CID106658180
Molecular FormulaC9H17NO4
Molecular Weight203.24 g/mol
Exact Mass203.12
IUPAC Name3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid
SMILESCC1(C)OCC(NCCC(=O)O)CO1
InChIInChI=1S/C9H17NO4/c1-9(2)13-5-7(6-14-9)10-4-3-8(11)12/h7,10H,3-6H2,1-2H3,(H,11,12)
InChIKeyLEJDJZDBZBBKEU-UHFFFAOYSA-N
XLogP0.20
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 50.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid?
The IUPAC name of 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid (CID 106658180) is 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid.
What is the SMILES notation for 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid?
The canonical SMILES for 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid is CC1(C)OCC(NCCC(=O)O)CO1.
What is the InChIKey of 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid?
The InChIKey is LEJDJZDBZBBKEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-9(2)13-5-7(6-14-9)10-4-3-8(11)12/h7,10H,3-6H2,1-2H3,(H,11,12).
What are the key properties of 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid?
3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid has a molecular weight of 203.24 g/mol, XLogP of 0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid is sourced from PubChem (CID 106658180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).