C9H17NO4 — CID 106658180
3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid (PubChem CID 106658180) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid.
| Compound Name | 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 106658180 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propanoic acid |
| SMILES | CC1(C)OCC(NCCC(=O)O)CO1 |
| InChI | InChI=1S/C9H17NO4/c1-9(2)13-5-7(6-14-9)10-4-3-8(11)12/h7,10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | LEJDJZDBZBBKEU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |