C16H24N2O3 — CID 106658655
N-[2-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-methylbenzamide (PubChem CID 106658655) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 106658655 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[2-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC2COC(C)(C)OC2)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-12-4-6-13(7-5-12)15(19)18-9-8-17-14-10-20-16(2,3)21-11-14/h4-7,14,17H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | WBEPCHGOHBCVOM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|