C10H21NO3S — CID 106659028
2,2-dimethyl-N-(3-methylsulfinylpropyl)-1,3-dioxan-5-amine (PubChem CID 106659028) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-methylsulfinylpropyl)-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-(3-methylsulfinylpropyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106659028 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2,2-dimethyl-N-(3-methylsulfinylpropyl)-1,3-dioxan-5-amine |
| SMILES | CS(=O)CCCNC1COC(C)(C)OC1 |
| InChI | InChI=1S/C10H21NO3S/c1-10(2)13-7-9(8-14-10)11-5-4-6-15(3)12/h9,11H,4-8H2,1-3H3 |
| InChIKey | YORWGJIRUDWGFN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|