About 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol
2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol (PubChem CID 106309374) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol.
Molecular Properties
| Compound Name | 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol |
| PubChem CID | 106309374 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol |
| SMILES | CC1(C)OCC(NCCCOCCO)CO1 |
| InChI | InChI=1S/C11H23NO4/c1-11(2)15-8-10(9-16-11)12-4-3-6-14-7-5-13/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | NVWQSYPETIJUHT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol?
The IUPAC name of 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol (CID 106309374) is 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol.
What is the SMILES notation for 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol?
The canonical SMILES for 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol is CC1(C)OCC(NCCCOCCO)CO1.
What is the InChIKey of 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol?
The InChIKey is NVWQSYPETIJUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4/c1-11(2)15-8-10(9-16-11)12-4-3-6-14-7-5-13/h10,12-13H,3-9H2,1-2H3.
What are the key properties of 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol?
2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol has a molecular weight of 233.31 g/mol, XLogP of 0.13, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]propoxy]ethanol is sourced from PubChem (CID 106309374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).