C12H25NOS — CID 75508869
3,4-dimethyl-N-(3-methylsulfinylpropyl)cyclohexan-1-amine (PubChem CID 75508869) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is 3,4-dimethyl-N-(3-methylsulfinylpropyl)cyclohexan-1-amine.
| Compound Name | 3,4-dimethyl-N-(3-methylsulfinylpropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 75508869 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3,4-dimethyl-N-(3-methylsulfinylpropyl)cyclohexan-1-amine |
| SMILES | CC1CCC(NCCCS(C)=O)CC1C |
| InChI | InChI=1S/C12H25NOS/c1-10-5-6-12(9-11(10)2)13-7-4-8-15(3)14/h10-13H,4-9H2,1-3H3 |
| InChIKey | QIUFNXKGQNULCG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|