C13H27NO — CID 64741111
5-[(3,4-dimethylcyclohexyl)amino]pentan-1-ol (PubChem CID 64741111) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 5-[(3,4-dimethylcyclohexyl)amino]pentan-1-ol.
| Compound Name | 5-[(3,4-dimethylcyclohexyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 64741111 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 5-[(3,4-dimethylcyclohexyl)amino]pentan-1-ol |
| SMILES | CC1CCC(NCCCCCO)CC1C |
| InChI | InChI=1S/C13H27NO/c1-11-6-7-13(10-12(11)2)14-8-4-3-5-9-15/h11-15H,3-10H2,1-2H3 |
| InChIKey | SXHIWKTYLIGBBG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|