C13H13Cl3N2O — CID 102673162
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine (PubChem CID 102673162) has the molecular formula C13H13Cl3N2O and a molecular weight of 319.62 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine |
|---|---|
| PubChem CID | 102673162 |
| Molecular Formula | C13H13Cl3N2O |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine |
| SMILES | Cc1nc(CNCc2c(Cl)ccc(Cl)c2Cl)oc1C |
| InChI | InChI=1S/C13H13Cl3N2O/c1-7-8(2)19-12(18-7)6-17-5-9-10(14)3-4-11(15)13(9)16/h3-4,17H,5-6H2,1-2H3 |
| InChIKey | FZGHORLYRQLCHA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|