About 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine
2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine (PubChem CID 106370731) has the molecular formula C11H15N3OS
and a molecular weight of 237.33 g/mol. Its IUPAC name is 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine.
Molecular Properties
| Compound Name | 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine |
| PubChem CID | 106370731 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine |
| SMILES | Cc1nc(CNCc2sccc2N)oc1C |
| InChI | InChI=1S/C11H15N3OS/c1-7-8(2)15-11(14-7)6-13-5-10-9(12)3-4-16-10/h3-4,13H,5-6,12H2,1-2H3 |
| InChIKey | NCDCJJQFCBBREI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine?
The IUPAC name of 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine (CID 106370731) is 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine.
What is the SMILES notation for 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine?
The canonical SMILES for 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine is Cc1nc(CNCc2sccc2N)oc1C.
What is the InChIKey of 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine?
The InChIKey is NCDCJJQFCBBREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3OS/c1-7-8(2)15-11(14-7)6-13-5-10-9(12)3-4-16-10/h3-4,13H,5-6,12H2,1-2H3.
What are the key properties of 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine?
2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine has a molecular weight of 237.33 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]methyl]thiophen-3-amine is sourced from PubChem (CID 106370731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).