C11H14N2S2 — CID 66385189
2-[[(5-methylthiophen-2-yl)methylamino]methyl]thiophen-3-amine (PubChem CID 66385189) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-[[(5-methylthiophen-2-yl)methylamino]methyl]thiophen-3-amine.
| Compound Name | 2-[[(5-methylthiophen-2-yl)methylamino]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66385189 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-[[(5-methylthiophen-2-yl)methylamino]methyl]thiophen-3-amine |
| SMILES | Cc1ccc(CNCc2sccc2N)s1 |
| InChI | InChI=1S/C11H14N2S2/c1-8-2-3-9(15-8)6-13-7-11-10(12)4-5-14-11/h2-5,13H,6-7,12H2,1H3 |
| InChIKey | NGPPSXYKFGDXLR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |